CAS 1000673-59-5 appears in our catalog under these names: Rizatriptan EP Impurity G, 3-(2-Chloroethyl)-5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indole, 5-((1H-1,2,4-Triazol-1-yl)methyl)-3-(2-chloroethyl)-1H-indole 97%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 500mg, 100mg, 250mg, 1g.
3-(2-chloroethyl)-5-(1,2,4-triazol-1-ylmethyl)-1H-indole (CAS 1000673-59-5) is a chemical compound with the molecular formula C13H13ClN4 and a molecular weight of 260.72 g/mol. IUPAC name: 3-(2-chloroethyl)-5-(1,2,4-triazol-1-ylmethyl)-1H-indole. InChIKey: DBXSXTJZLPJJHE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN4 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 3-(2-chloroethyl)-5-(1,2,4-triazol-1-ylmethyl)-1H-indole |
| InChIKey | DBXSXTJZLPJJHE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN3C=NC=N3)C(=CN2)CCCl |
Computed by PubChem (NCBI)