CAS 54752-92-0 appears in our catalog under these names: 7-Amino-2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium chloride, 95%, 2,4-Dimethylpyrimido(2,1-a)phthalazin-5-ium-7-amine,chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine chloride (CAS 54752-92-0) is a chemical compound with the molecular formula C13H13ClN4 and a molecular weight of 260.72 g/mol. IUPAC name: 2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine chloride. InChIKey: RRRWQKYESAAWKM-UHFFFAOYSA-M.
| Molecular formula | C13H13ClN4 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine chloride |
| InChIKey | RRRWQKYESAAWKM-UHFFFAOYSA-M |
| SMILES | CC1=CC(=[N+]2C(=N1)C3=CC=CC=C3C(=N2)N)C.[Cl-] |
Computed by PubChem (NCBI)