Products 1000700-29-7
CAS 1000700-29-7 is the registry number for (S)-Otenaproxesul. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-carbamothioylphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CAS 1000700-29-7) is a chemical compound with the molecular formula C21H19NO3S and a molecular weight of 365.4 g/mol. IUPAC name: (4-carbamothioylphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: YCNMAPLPQYQJFC-ZDUSSCGKSA-N.
| Molecular formula | C21H19NO3S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (4-carbamothioylphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | YCNMAPLPQYQJFC-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OC3=CC=C(C=C3)C(=S)N |
Computed by PubChem (NCBI)