CAS 1226895-20-0 appears in our catalog under these names: 4-Carbamothioylphenyl 2-(6-methoxynaphthalen-2-yl)propanoate, 95%, Otenaproxesul/ 97.98% (existing batch purity), ATB–346, ATB 346, ATB 346, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
(4-carbamothioylphenyl) 2-(6-methoxynaphthalen-2-yl)propanoate (CAS 1226895-20-0) is a chemical compound with the molecular formula C21H19NO3S and a molecular weight of 365.4 g/mol. IUPAC name: (4-carbamothioylphenyl) 2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: YCNMAPLPQYQJFC-UHFFFAOYSA-N.
| Molecular formula | C21H19NO3S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (4-carbamothioylphenyl) 2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | YCNMAPLPQYQJFC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OC3=CC=C(C=C3)C(=S)N |
Computed by PubChem (NCBI)