Products 1000930-32-4
CAS 1000930-32-4 is the registry number for N-Benzyl-2-chloro-n-(4,5-dimethyl-1,3-benzothiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-benzyl-2-chloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)acetamide (CAS 1000930-32-4) is a chemical compound with the molecular formula C18H17ClN2OS and a molecular weight of 344.9 g/mol. IUPAC name: N-benzyl-2-chloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)acetamide. InChIKey: MEGDDPBJSBYRRI-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2OS |
|---|---|
| Molecular weight | 344.9 g/mol |
| IUPAC name | N-benzyl-2-chloro-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)acetamide |
| InChIKey | MEGDDPBJSBYRRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)SC(=N2)N(CC3=CC=CC=C3)C(=O)CCl)C |
Computed by PubChem (NCBI)