Products 1022288-39-6
CAS 1022288-39-6 is the registry number for 2-(4-chlorophenylthio)-N-(2-indol-3-ylethyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-chlorophenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]acetamide (CAS 1022288-39-6) is a chemical compound with the molecular formula C18H17ClN2OS and a molecular weight of 344.9 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]acetamide. InChIKey: OMBPCKONELMAHW-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2OS |
|---|---|
| Molecular weight | 344.9 g/mol |
| IUPAC name | 2-(4-chlorophenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| InChIKey | OMBPCKONELMAHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)CSC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)