CAS 1000932-27-3 is the registry number for 4-Bromo-N-(4-hydroxyphenyl)-N-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-bromo-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide (CAS 1000932-27-3) is a chemical compound with the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. IUPAC name: 4-bromo-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide. InChIKey: MUGMYUDZLFWOOQ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3S |
|---|---|
| Molecular weight | 342.21 g/mol |
| IUPAC name | 4-bromo-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide |
| InChIKey | MUGMYUDZLFWOOQ-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)O)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)