CAS 7454-72-0 appears in our catalog under these names: 4-Bromo-N-(4-methoxyphenyl)benzenesulfonamide, 95%, 4–Bromo–N–(4–methoxyphenyl)benzenesulfonamide. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
4-bromo-N-(4-methoxyphenyl)benzenesulfonamide (CAS 7454-72-0) is a chemical compound with the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. IUPAC name: 4-bromo-N-(4-methoxyphenyl)benzenesulfonamide. InChIKey: RQCJPHFHAJZWBS-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3S |
|---|---|
| Molecular weight | 342.21 g/mol |
| IUPAC name | 4-bromo-N-(4-methoxyphenyl)benzenesulfonamide |
| InChIKey | RQCJPHFHAJZWBS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)