Products 1000995-94-7

CAS 1000995-94-7 is the registry number for Ethyl 4–fluoro–4–methyl–2–pent–4–enamidopentanoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoate (CAS 1000995-94-7) is a chemical compound with the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. IUPAC name: ethyl 4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoate. InChIKey: HWSFRFALWWYHTN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22FNO3
Molecular weight259.32 g/mol
IUPAC nameethyl 4-fluoro-4-methyl-2-(pent-4-enoylamino)pentanoate
InChIKeyHWSFRFALWWYHTN-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(C)(C)F)NC(=O)CCC=C

Computed by PubChem (NCBI)