CAS 1638757-73-9 is the registry number for tert-butyl(7R,8R)-7-fluoro-8-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (7R,8R)-8-fluoro-7-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate (CAS 1638757-73-9) is a chemical compound with the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. IUPAC name: tert-butyl (7R,8R)-8-fluoro-7-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate. InChIKey: DFEPWEAHBHVUKN-NJEVMQCVSA-N.
| Molecular formula | C13H22FNO3 |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | tert-butyl (7R,8R)-8-fluoro-7-hydroxy-2-azaspiro[4.4]nonane-2-carboxylate |
| InChIKey | DFEPWEAHBHVUKN-NJEVMQCVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C[C@H]([C@@H](C2)F)O |
Computed by PubChem (NCBI)