CAS 100108-77-8 appears in our catalog under these names: L-Alanine-13C3, >95% (HPLC), L–Alanine–13C3, L-ALANINE-13C3, 98 ATOM % 13C, 95% CP, L-Alanine-13C3, 99.90%. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 100MG, 5 mg.
(2S)-2-amino(1,2,3-13C3)propanoic acid (CAS 100108-77-8) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 92.072 g/mol. IUPAC name: (2S)-2-amino(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-GCCOVPGMSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 92.072 g/mol |
| IUPAC name | (2S)-2-amino(1,2,3-13C3)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-GCCOVPGMSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)