Products 1001180-59-1
CAS 1001180-59-1 is the registry number for 4-(tert-Butyl) 1-methyl 2-(4-chlorophenyl)succinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)butanedioate (CAS 1001180-59-1) is a chemical compound with the molecular formula C15H19ClO4 and a molecular weight of 298.76 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)butanedioate. InChIKey: CKNFCOKFDDXTGX-UHFFFAOYSA-N.
| Molecular formula | C15H19ClO4 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl 2-(4-chlorophenyl)butanedioate |
| InChIKey | CKNFCOKFDDXTGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C1=CC=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)