CAS 1001336-74-8 is the registry number for 2-(4-Chloro-2-formyl-phenoxy)-2-methyl-propionic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-(4-chloro-2-formylphenoxy)-2-methylpropanoate (CAS 1001336-74-8) is a chemical compound with the molecular formula C15H19ClO4 and a molecular weight of 298.76 g/mol. IUPAC name: tert-butyl 2-(4-chloro-2-formylphenoxy)-2-methylpropanoate. InChIKey: YQDHSCLSICLTMP-UHFFFAOYSA-N.
| Molecular formula | C15H19ClO4 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | tert-butyl 2-(4-chloro-2-formylphenoxy)-2-methylpropanoate |
| InChIKey | YQDHSCLSICLTMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C)OC1=C(C=C(C=C1)Cl)C=O |
Computed by PubChem (NCBI)