CAS 1001242-49-4 is the registry number for SARS-CoV-2-IN-52. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-amino-2-(naphthalen-1-ylmethylamino)-1,7-dihydroimidazo[4,5-g]quinazolin-8-one (CAS 1001242-49-4) is a chemical compound with the molecular formula C20H16N6O and a molecular weight of 356.4 g/mol. IUPAC name: 6-amino-2-(naphthalen-1-ylmethylamino)-1,7-dihydroimidazo[4,5-g]quinazolin-8-one. InChIKey: MCEZMMDIEXECTI-UHFFFAOYSA-N.
| Molecular formula | C20H16N6O |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 6-amino-2-(naphthalen-1-ylmethylamino)-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
| InChIKey | MCEZMMDIEXECTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CNC3=NC4=C(N3)C=C5C(=C4)N=C(NC5=O)N |
Computed by PubChem (NCBI)