CAS 939431-68-2 appears in our catalog under these names: Etravirine Impurity 12, 4-((6-Amino-2-((4-cyanophenyl)amino)-4-pyrimidinyl)oxy)-3,5-dimethylbenzonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-[6-amino-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CAS 939431-68-2) is a chemical compound with the molecular formula C20H16N6O and a molecular weight of 356.4 g/mol. IUPAC name: 4-[6-amino-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile. InChIKey: QELKPCHCXREHAE-UHFFFAOYSA-N.
| Molecular formula | C20H16N6O |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-[6-amino-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| InChIKey | QELKPCHCXREHAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=NC(=NC(=C2)N)NC3=CC=C(C=C3)C#N)C)C#N |
Computed by PubChem (NCBI)