Products 1001335-40-5

CAS 1001335-40-5 is the registry number for [2-(4-Chloro-2-formyl-phenoxy)-ethyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Tert-butyl N-[2-(4-chloro-2-formylphenoxy)ethyl]carbamate (CAS 1001335-40-5) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: tert-butyl N-[2-(4-chloro-2-formylphenoxy)ethyl]carbamate. InChIKey: VHDPZRUKRLPEER-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18ClNO4
Molecular weight299.75 g/mol
IUPAC nametert-butyl N-[2-(4-chloro-2-formylphenoxy)ethyl]carbamate
InChIKeyVHDPZRUKRLPEER-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCOC1=C(C=C(C=C1)Cl)C=O

Computed by PubChem (NCBI)