CAS 1001353-82-7 is the registry number for 2,4-dichloropyrrolo(2,1-f)(1,2,4)triazine-7-carbaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde (CAS 1001353-82-7) is a chemical compound with the molecular formula C7H3Cl2N3O and a molecular weight of 216.02 g/mol. IUPAC name: 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde. InChIKey: BPZJNMLBWODZEC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde |
| InChIKey | BPZJNMLBWODZEC-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1)C(=NC(=N2)Cl)Cl)C=O |
Computed by PubChem (NCBI)