CAS 2820180-24-1 is the registry number for 6,7-Dichloropyrido[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2820180-24-1) is a chemical compound with the molecular formula C7H3Cl2N3O and a molecular weight of 216.02 g/mol. IUPAC name: 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: AVKSACCPUAKWDS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | AVKSACCPUAKWDS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=O)NC=NC2=NC(=C1Cl)Cl |
Computed by PubChem (NCBI)