CAS 1001518-88-2 is the registry number for 4-{(3,5-Bis(difluoromethyl)-1H-pyrazol-1-yl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]benzoic acid (CAS 1001518-88-2) is a chemical compound with the molecular formula C13H10F4N2O2 and a molecular weight of 302.22 g/mol. IUPAC name: 4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]benzoic acid. InChIKey: DGHPTFYMFHGEAJ-UHFFFAOYSA-N.
| Molecular formula | C13H10F4N2O2 |
|---|---|
| Molecular weight | 302.22 g/mol |
| IUPAC name | 4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]benzoic acid |
| InChIKey | DGHPTFYMFHGEAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=CC(=N2)C(F)F)C(F)F)C(=O)O |
Computed by PubChem (NCBI)