CAS 2354391-45-8 appears in our catalog under these names: Elagolix Impurity 40, Elagolix Impurity 94, 3-((2-Fluoro-6-(trifluoromethyl)phenyl)methyl)-6-methyl-2,4(1H,3H)-pyrimidinedione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
3-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-1H-pyrimidine-2,4-dione (CAS 2354391-45-8) is a chemical compound with the molecular formula C13H10F4N2O2 and a molecular weight of 302.22 g/mol. IUPAC name: 3-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-1H-pyrimidine-2,4-dione. InChIKey: SLPKPFFGLJLMQR-UHFFFAOYSA-N.
| Molecular formula | C13H10F4N2O2 |
|---|---|
| Molecular weight | 302.22 g/mol |
| IUPAC name | 3-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-1H-pyrimidine-2,4-dione |
| InChIKey | SLPKPFFGLJLMQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=O)N1)CC2=C(C=CC=C2F)C(F)(F)F |
Computed by PubChem (NCBI)