CAS 1001519-40-9 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-pyrazole-3-carbohydrazide, 95%, 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide, 95+%, 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 5g.
1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide (CAS 1001519-40-9) is a chemical compound with the molecular formula C6H7F3N4O and a molecular weight of 208.14 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide. InChIKey: JEMCLXOSBQIDKX-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4O |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide |
| InChIKey | JEMCLXOSBQIDKX-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)NN)C(F)(F)F |
Computed by PubChem (NCBI)