CAS 1692449-25-4 is the registry number for 4-Amino-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide (CAS 1692449-25-4) is a chemical compound with the molecular formula C6H7F3N4O and a molecular weight of 208.14 g/mol. IUPAC name: 4-amino-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide. InChIKey: CACGURYDBCHUNR-UHFFFAOYSA-N.
| Molecular formula | C6H7F3N4O |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 4-amino-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide |
| InChIKey | CACGURYDBCHUNR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)(F)F)C(=O)N)N |
Computed by PubChem (NCBI)