CAS 100162-30-9 appears in our catalog under these names: 1,3-Dioxo-2-[4-(propoxycarbonyl)phenyl]isoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-(4-(propoxycarbonyl)phenyl)isoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylic acid (CAS 100162-30-9) is a chemical compound with the molecular formula C19H15NO6 and a molecular weight of 353.3 g/mol. IUPAC name: 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylic acid. InChIKey: QGDKSFMFDCRKCL-UHFFFAOYSA-N.
| Molecular formula | C19H15NO6 |
|---|---|
| Molecular weight | 353.3 g/mol |
| IUPAC name | 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylic acid |
| InChIKey | QGDKSFMFDCRKCL-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)