CAS 1185071-64-0 appears in our catalog under these names: Acenocoumarol-d4, >95% (HPLC), Acenocoumarol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-hydroxy-3-[3-oxo-1-(2,3,5,6-tetradeuterio-4-nitrophenyl)butyl]chromen-2-one (CAS 1185071-64-0) is a chemical compound with the molecular formula C19H15NO6 and a molecular weight of 357.3 g/mol. IUPAC name: 4-hydroxy-3-[3-oxo-1-(2,3,5,6-tetradeuterio-4-nitrophenyl)butyl]chromen-2-one. InChIKey: VABCILAOYCMVPS-YKVCKAMESA-N.
| Molecular formula | C19H15NO6 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | 4-hydroxy-3-[3-oxo-1-(2,3,5,6-tetradeuterio-4-nitrophenyl)butyl]chromen-2-one |
| InChIKey | VABCILAOYCMVPS-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(CC(=O)C)C2=C(C3=CC=CC=C3OC2=O)O)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)