Products 10017-39-7
CAS 10017-39-7 appears in our catalog under these names: 2-(Aminomethyl)benzoic acid hydrochloride, 95%, 2–(Aminomethyl)benzoic acid hydrochloride, 2-(Aminomethyl)benzoic acid hydrochloride, 2-(Aminomethyl)benzoic acid hydrochloride 96%, 2-(AMINOMETHYL)BENZOIC ACID HYDROCHLORI&. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 50mg, 500mg.
2-(aminomethyl)benzoic acid;hydrochloride (CAS 10017-39-7) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2-(aminomethyl)benzoic acid;hydrochloride. InChIKey: HWHUNDJAGYQZHL-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2-(aminomethyl)benzoic acid;hydrochloride |
| InChIKey | HWHUNDJAGYQZHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(aminomethyl)benzoic acid hydrochloride, 2-(aminomethyl)benzoic acid;hydrochloride, 2-Aminomethylbenzoic acid hydrochloride, 2-(Aminomethyl)benzoic acid hydrochloride, 95%, 2-(Aminomethyl)benzoic acid--hydrogen chloride (1/1), 2-(aminomethyl)b, 2-(aminomethyl)benzoicacidhydrochloride, (3-Aminomethyl)benzoic acid hydrochloride