CAS 1001753-24-7 appears in our catalog under these names: Inh6, 95%, INH6, 98+%, INH6, INH6/ 99.17% (existing batch purity), INH6 98+%. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Chemat. Available pack sizes: 100mg, 1g, 10mg, 50mg, 25mg, 250mg, 50 mg, 5 mg.
N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide (CAS 1001753-24-7) is a chemical compound with the molecular formula C19H18N2OS and a molecular weight of 322.4 g/mol. IUPAC name: N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide. InChIKey: WCZLNJTXHZPHLM-UHFFFAOYSA-N.
| Molecular formula | C19H18N2OS |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide |
| InChIKey | WCZLNJTXHZPHLM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CSC(=N2)NC(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)