Products 1024278-14-5
CAS 1024278-14-5 is the registry number for N-(1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide (CAS 1024278-14-5) is a chemical compound with the molecular formula C19H18N2OS and a molecular weight of 322.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide. InChIKey: NGXTVIOATRVAOB-UHFFFAOYSA-N.
| Molecular formula | C19H18N2OS |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | NGXTVIOATRVAOB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)