CAS 100199-40-4 appears in our catalog under these names: 4-Dehydroxy-4-chloro Penciclovir, Penciclovir Impurity 1, Pencyclovir Impurity 1, 2-Amino-9-(4-chloro-3-(hydroxymethyl)butyl)-1,9-dihydro-6H-purin-6-one 98%, 2-Amino-9-(4-chloro-3-(hydroxymethyl)butyl)-1,9-dihydro-6H-purin-6-one, 98%, 98%. Offered by: TRC, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, on request, 1mg, 2mg, 5mg, 100mg.
2-amino-9-[3-(chloromethyl)-4-hydroxybutyl]-1H-purin-6-one (CAS 100199-40-4) is a chemical compound with the molecular formula C10H14ClN5O2 and a molecular weight of 271.70 g/mol. IUPAC name: 2-amino-9-[3-(chloromethyl)-4-hydroxybutyl]-1H-purin-6-one. InChIKey: KUNXFLMNYSWWKC-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN5O2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 2-amino-9-[3-(chloromethyl)-4-hydroxybutyl]-1H-purin-6-one |
| InChIKey | KUNXFLMNYSWWKC-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CCC(CO)CCl)N=C(NC2=O)N |
Computed by PubChem (NCBI)