CAS 1432903-09-7 is the registry number for N'-[(1E)-(4-Amino-6-chloropyrimidin-5-yl)methylidene](tert-butoxy)carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(E)-(4-amino-6-chloropyrimidin-5-yl)methylideneamino]carbamate (CAS 1432903-09-7) is a chemical compound with the molecular formula C10H14ClN5O2 and a molecular weight of 271.70 g/mol. IUPAC name: tert-butyl N-[(E)-(4-amino-6-chloropyrimidin-5-yl)methylideneamino]carbamate. InChIKey: IQYKZYJEZUFSMT-SYZQJQIISA-N.
| Molecular formula | C10H14ClN5O2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | tert-butyl N-[(E)-(4-amino-6-chloropyrimidin-5-yl)methylideneamino]carbamate |
| InChIKey | IQYKZYJEZUFSMT-SYZQJQIISA-N |
| SMILES | CC(C)(C)OC(=O)N/N=C/C1=C(N=CN=C1Cl)N |
Computed by PubChem (NCBI)