CAS 1002101-19-0 appears in our catalog under these names: 2-(3-Pentylphenyl)acetic acid, 98%, Fezagepras/ 99.38% (existing batch purity), Fezagepras, 2-(3-Pentylphenyl)acetic acid, Fezagepras 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-(3-pentylphenyl)acetic acid (CAS 1002101-19-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2-(3-pentylphenyl)acetic acid. InChIKey: PEGQOIGYZLJMIB-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-(3-pentylphenyl)acetic acid |
| InChIKey | PEGQOIGYZLJMIB-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=CC=C1)CC(=O)O |
Computed by PubChem (NCBI)