CAS 10023-29-7 appears in our catalog under these names: 7-Methylbenzo(1,2-d:4,3-d')bis(thiazole)-2-amine, 97%, 7-Methyl-benzo(1,2-D:4,3-D')bisthiazol-2-ylamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-amine (CAS 10023-29-7) is a chemical compound with the molecular formula C9H7N3S2 and a molecular weight of 221.3 g/mol. IUPAC name: 7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-amine. InChIKey: LINJMDWVMVEFLA-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 7-methyl-[1,3]thiazolo[4,5-g][1,3]benzothiazol-2-amine |
| InChIKey | LINJMDWVMVEFLA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)