CAS 10023-31-1 appears in our catalog under these names: 7-Methyl-benzo[1,2-d:3,4-d']bisthiazol-2-ylamine, 95%, 7-Methylbenzo(1,2-d:3,4-d')bis(thiazole)-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine (CAS 10023-31-1) is a chemical compound with the molecular formula C9H7N3S2 and a molecular weight of 221.3 g/mol. IUPAC name: 7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine. InChIKey: UCLUWGOFEQZGBZ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-amine |
| InChIKey | UCLUWGOFEQZGBZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC3=C2SC(=N3)N |
Computed by PubChem (NCBI)