CAS 1002355-90-9 is the registry number for tert-Butyl 3-(trifluoroacetamido)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 3-[(2,2,2-trifluoroacetyl)amino]azetidine-1-carboxylate (CAS 1002355-90-9) is a chemical compound with the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. IUPAC name: tert-butyl 3-[(2,2,2-trifluoroacetyl)amino]azetidine-1-carboxylate. InChIKey: DHMAZLCUBRMXDX-UHFFFAOYSA-N.
| Molecular formula | C10H15F3N2O3 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | tert-butyl 3-[(2,2,2-trifluoroacetyl)amino]azetidine-1-carboxylate |
| InChIKey | DHMAZLCUBRMXDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)