CAS 2378502-74-8 is the registry number for 1-(2,6-Diazaspiro(3.4)octan-6-yl)ethan-1-one 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,6-diazaspiro[3.4]octan-6-yl)ethanone;2,2,2-trifluoroacetic acid (CAS 2378502-74-8) is a chemical compound with the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. IUPAC name: 1-(2,6-diazaspiro[3.4]octan-6-yl)ethanone;2,2,2-trifluoroacetic acid. InChIKey: XNMLQVLLLVOOJK-UHFFFAOYSA-N.
| Molecular formula | C10H15F3N2O3 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 1-(2,6-diazaspiro[3.4]octan-6-yl)ethanone;2,2,2-trifluoroacetic acid |
| InChIKey | XNMLQVLLLVOOJK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2(C1)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)