CAS 1002359-81-0 is the registry number for Perospirone Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(7aR)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (CAS 1002359-81-0) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: (7aR)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione. InChIKey: WLDMPODMCFGWAA-LWOQYNTDSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (7aR)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| InChIKey | WLDMPODMCFGWAA-LWOQYNTDSA-N |
| SMILES | C1CCC2[C@@H](C1)C(=O)NC2=O |
Computed by PubChem (NCBI)