CAS 7188-16-1 appears in our catalog under these names: Benzeneacetic acid, ammonium salt (1:1), 95%, 95%, Ammonium phenyl acetate, 95%, ammonium phenyl acetate, Ammonium 2-phenylacetate. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 50g.
Azanium 2-phenylacetate (CAS 7188-16-1) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: azanium 2-phenylacetate. InChIKey: PQILKFQDIYPBKI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | azanium 2-phenylacetate |
| InChIKey | PQILKFQDIYPBKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)[O-].[NH4+] |
Computed by PubChem (NCBI)