Products 100269-88-3
CAS 100269-88-3 is the registry number for 1,2-Dideoxy-3,5-di-O-toluoyl-D-ribose. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg.
(2S,3R)-2-ethyl-2,3,4-trihydroxy-1,5-bis(2-methylphenyl)pentane-1,5-dione (CAS 100269-88-3) is a chemical compound with the molecular formula C21H24O5 and a molecular weight of 356.4 g/mol. IUPAC name: (2S,3R)-2-ethyl-2,3,4-trihydroxy-1,5-bis(2-methylphenyl)pentane-1,5-dione. InChIKey: GAUKSPHJTDBYFO-VTVVEXCCSA-N.
| Molecular formula | C21H24O5 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2S,3R)-2-ethyl-2,3,4-trihydroxy-1,5-bis(2-methylphenyl)pentane-1,5-dione |
| InChIKey | GAUKSPHJTDBYFO-VTVVEXCCSA-N |
| SMILES | CC[C@]([C@@H](C(C(=O)C1=CC=CC=C1C)O)O)(C(=O)C2=CC=CC=C2C)O |
Computed by PubChem (NCBI)