CAS 1002724-02-8 is the registry number for methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-3-(tert-butylsulfanyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1002724-02-8) is a chemical compound with the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. IUPAC name: methyl (2R)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: AOEQHXLRZKWFHF-VIFPVBQESA-N.
| Molecular formula | C13H25NO4S |
|---|---|
| Molecular weight | 291.41 g/mol |
| IUPAC name | methyl (2R)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | AOEQHXLRZKWFHF-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)