CAS 630108-94-0 appears in our catalog under these names: (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-4-mercaptobutanoate, 95%, (S)-tert-Butyl 2-(tert-butoxycarbonylamino)-4-mercaptobutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,25g, 0,5g.
Tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoate (CAS 630108-94-0) is a chemical compound with the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoate. InChIKey: AFSKWXGSKKCBDW-VIFPVBQESA-N.
| Molecular formula | C13H25NO4S |
|---|---|
| Molecular weight | 291.41 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoate |
| InChIKey | AFSKWXGSKKCBDW-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCS)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)