CAS 10028-70-3 appears in our catalog under these names: Terephthalic acid disodium salt, 98%, Disodium Terephthalate, Disodium terephthalate, 99+% , Disodium Terephthalate, >99.0%(HPLC)(T), Disodium terephthalate 99%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 500g, 1000g, 1kg, 50g.
Disodium;terephthalate (CAS 10028-70-3) is a chemical compound with the molecular formula C8H4Na2O4 and a molecular weight of 210.09 g/mol. IUPAC name: disodium;terephthalate. InChIKey: VIQSRHWJEKERKR-UHFFFAOYSA-L.
| Molecular formula | C8H4Na2O4 |
|---|---|
| Molecular weight | 210.09 g/mol |
| IUPAC name | disodium;terephthalate |
| InChIKey | VIQSRHWJEKERKR-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)