CAS 15968-01-1 appears in our catalog under these names: Phthalic acid disodium salt, 95%, Sodium phthalate, Disodium Phthalate, >95.0%(T), Disodium phthalate 98%, Sodium 2-Carboxybenzoate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 500g, 100g, 25g, 1g, 10g.
Disodium;phthalate (CAS 15968-01-1) is a chemical compound with the molecular formula C8H4Na2O4 and a molecular weight of 210.09 g/mol. IUPAC name: disodium;phthalate. InChIKey: HQWKKEIVHQXCPI-UHFFFAOYSA-L.
| Molecular formula | C8H4Na2O4 |
|---|---|
| Molecular weight | 210.09 g/mol |
| IUPAC name | disodium;phthalate |
| InChIKey | HQWKKEIVHQXCPI-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)