Products 100287-06-7
CAS 100287-06-7 appears in our catalog under these names: 4-Hydroxyphenylacetic Acid-d6, >95% (HPLC), (4-Hydroxyphenyl-2,3,5,6-d4)acetic-2,2-d2 Acid, 98 atom % D, min 98% Chemical Purity, 4–Hydroxyphenylacetic acid–d6, 4-Hydroxyphenylacetic acid-d6, 99.16%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 50mg, 0,05g, 0,01g, 1mg, 5mg, 5 mg, 10 mg.
2,2-dideuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetic acid (CAS 100287-06-7) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.18 g/mol. IUPAC name: 2,2-dideuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetic acid. InChIKey: XQXPVVBIMDBYFF-NVSFMWKBSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 158.18 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetic acid |
| InChIKey | XQXPVVBIMDBYFF-NVSFMWKBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)