Products 1002916-47-3
CAS 1002916-47-3 appears in our catalog under these names: 4-(Azetidin-1-yl)-4-phenylcyclohexan-1-one, 95%, 4-(Azetidin-1-yl)-4-phenylcyclohexan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg.
4-(azetidin-1-yl)-4-phenylcyclohexan-1-one (CAS 1002916-47-3) is a chemical compound with the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. IUPAC name: 4-(azetidin-1-yl)-4-phenylcyclohexan-1-one. InChIKey: URYQTQDYBURNGY-UHFFFAOYSA-N.
| Molecular formula | C15H19NO |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | 4-(azetidin-1-yl)-4-phenylcyclohexan-1-one |
| InChIKey | URYQTQDYBURNGY-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C2(CCC(=O)CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)