Products 1242823-56-8
CAS 1242823-56-8 is the registry number for 1,2,2,4,7-Pentamethyl-1,2-dihydroquinoline-6-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1,2,2,4,7-pentamethylquinoline-6-carbaldehyde (CAS 1242823-56-8) is a chemical compound with the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. IUPAC name: 1,2,2,4,7-pentamethylquinoline-6-carbaldehyde. InChIKey: JGEOKZXKUZEPQD-UHFFFAOYSA-N.
| Molecular formula | C15H19NO |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | 1,2,2,4,7-pentamethylquinoline-6-carbaldehyde |
| InChIKey | JGEOKZXKUZEPQD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C=O)C(=CC(N2C)(C)C)C |
Computed by PubChem (NCBI)