Products 10030-52-1
CAS 10030-52-1 appears in our catalog under these names: L-Anserine nitrate/ 99.37% (existing batch purity), L–Anserine · nitrate, L-Anserine nitrate salt, L-Anserine nitrate, 95%, L-ANSERINE NITRATE SALT, HYDROXYL&. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 0,05g, 0,025g.
(2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid (CAS 10030-52-1) is a chemical compound with the molecular formula C10H17N5O6 and a molecular weight of 303.27 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid. InChIKey: OLWOKAYJAHHSNY-QRPNPIFTSA-N.
| Molecular formula | C10H17N5O6 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid |
| InChIKey | OLWOKAYJAHHSNY-QRPNPIFTSA-N |
| SMILES | CN1C=NC=C1C[C@@H](C(=O)O)NC(=O)CCN.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
L-Anserine nitrate, L-Histidine, beta-alanyl-3-methyl-, nitrate (1:?), L-Anserine nitrate salt, beta-Alanyl-3-methyl-L-histidine Nitrate, L-Anserine.nitrate, orb1221536, orb1302637, N-b-Alanyl-3-methyl-L-histidine nitrate, L-Anserine nitrate (H-b-Ala-L-His(3-Me)-OH), L-Anserine nitrate salt, hydroxyl radical scavenger