Products 5937-77-9
CAS 5937-77-9 is the registry number for L-Anserine Nitrate Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid (CAS 5937-77-9) is a chemical compound with the molecular formula C10H17N5O6 and a molecular weight of 303.27 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid. InChIKey: OLWOKAYJAHHSNY-QRPNPIFTSA-N.
| Molecular formula | C10H17N5O6 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid;nitric acid |
| InChIKey | OLWOKAYJAHHSNY-QRPNPIFTSA-N |
| SMILES | CN1C=NC=C1C[C@@H](C(=O)O)NC(=O)CCN.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
L-Anserine nitrate, L-Histidine, beta-alanyl-3-methyl-, nitrate (1:?), L-Anserine nitrate salt, beta-Alanyl-3-methyl-L-histidine Nitrate, L-Anserine.nitrate, orb1221536, orb1302637, N-b-Alanyl-3-methyl-L-histidine nitrate, L-Anserine nitrate (H-b-Ala-L-His(3-Me)-OH), L-Anserine nitrate salt, hydroxyl radical scavenger