Products 1003005-38-6
CAS 1003005-38-6 is the registry number for (E)-ethyl 2-(2-(3,5-difluorophenyl)hydrazono)propanoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (2E)-2-[(3,5-difluorophenyl)hydrazinylidene]propanoate (CAS 1003005-38-6) is a chemical compound with the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. IUPAC name: ethyl (2E)-2-[(3,5-difluorophenyl)hydrazinylidene]propanoate. InChIKey: KAIMZRPZKBXDEG-VGOFMYFVSA-N.
| Molecular formula | C11H12F2N2O2 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | ethyl (2E)-2-[(3,5-difluorophenyl)hydrazinylidene]propanoate |
| InChIKey | KAIMZRPZKBXDEG-VGOFMYFVSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC(=CC(=C1)F)F)/C |
Computed by PubChem (NCBI)