Products 1784748-23-7
CAS 1784748-23-7 is the registry number for (3S,4R)-3-Amino-4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-3-amino-4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one (CAS 1784748-23-7) is a chemical compound with the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. IUPAC name: (3S,4R)-3-amino-4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one. InChIKey: UWHGOMCKFDRAFW-WKEGUHRASA-N.
| Molecular formula | C11H12F2N2O2 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | (3S,4R)-3-amino-4-(2,6-difluoro-4-methoxyphenyl)pyrrolidin-2-one |
| InChIKey | UWHGOMCKFDRAFW-WKEGUHRASA-N |
| SMILES | COC1=CC(=C(C(=C1)F)[C@@H]2CNC(=O)[C@H]2N)F |
Computed by PubChem (NCBI)