Products 1003708-31-3
CAS 1003708-31-3 is the registry number for 2-Bromo-4-(trifluoromethoxy)nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
2-bromo-1-nitro-4-(trifluoromethoxy)benzene (CAS 1003708-31-3) is a chemical compound with the molecular formula C7H3BrF3NO3 and a molecular weight of 286.00 g/mol. IUPAC name: 2-bromo-1-nitro-4-(trifluoromethoxy)benzene. InChIKey: KIGJNTZXRXZBQO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO3 |
|---|---|
| Molecular weight | 286.00 g/mol |
| IUPAC name | 2-bromo-1-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | KIGJNTZXRXZBQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)