CAS 1445995-70-9 is the registry number for 3-Bromo-6-nitro-2-(trifluoromethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-6-nitro-2-(trifluoromethyl)phenol (CAS 1445995-70-9) is a chemical compound with the molecular formula C7H3BrF3NO3 and a molecular weight of 286.00 g/mol. IUPAC name: 3-bromo-6-nitro-2-(trifluoromethyl)phenol. InChIKey: KGXNHGYCQFAOTL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO3 |
|---|---|
| Molecular weight | 286.00 g/mol |
| IUPAC name | 3-bromo-6-nitro-2-(trifluoromethyl)phenol |
| InChIKey | KGXNHGYCQFAOTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])O)C(F)(F)F)Br |
Computed by PubChem (NCBI)